C21H40O6Si — CID 177409359
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5S)-5-[(2S)-2-hydroxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoic acid (PubChem CID 177409359) has the molecular formula C21H40O6Si and a molecular weight of 416.63 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5S)-5-[(2S)-2-hydroxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoic acid.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5S)-5-[(2S)-2-hydroxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoic acid |
|---|---|
| PubChem CID | 177409359 |
| Molecular Formula | C21H40O6Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5S)-5-[(2S)-2-hydroxypentyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoic acid |
| SMILES | CCC[C@H](O)C[C@@H]1OC(C)(C)O[C@H]1C=C[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O6Si/c1-9-10-15(22)13-18-17(25-21(5,6)26-18)12-11-16(14-19(23)24)27-28(7,8)20(2,3)4/h11-12,15-18,22H,9-10,13-14H2,1-8H3,(H,23,24)/t15-,16+,17-,18-/m0/s1 |
| InChIKey | ZXDNWHZZUDLDBI-MHORFTMASA-N |
| XLogP | 4.48 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|