C27H50O5Si — CID 72708010
[(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octyl] (4S)-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate (PubChem CID 72708010) has the molecular formula C27H50O5Si and a molecular weight of 482.78 g/mol. Its IUPAC name is [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octyl] (4S)-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate.
| Compound Name | [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octyl] (4S)-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
|---|---|
| PubChem CID | 72708010 |
| Molecular Formula | C27H50O5Si |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | [(1R)-1-[(4R,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]octyl] (4S)-4-[tert-butyl(dimethyl)silyl]oxyhex-5-enoate |
| SMILES | C=C[C@H](CCC(=O)O[C@H](CCCCCCC)[C@H]1OC(C)(C)O[C@H]1C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O5Si/c1-11-14-15-16-17-18-23(25-22(13-3)30-27(7,8)31-25)29-24(28)20-19-21(12-2)32-33(9,10)26(4,5)6/h12-13,21-23,25H,2-3,11,14-20H2,1,4-10H3/t21-,22+,23-,25+/m1/s1 |
| InChIKey | LFSVEOJEHAHSQC-QENXHYHDSA-N |
| XLogP | 7.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|