C29H54O5Si — CID 10994821
ethyl (Z)-10-[(4S,5R)-5-[(Z,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]dec-9-enoate (PubChem CID 10994821) has the molecular formula C29H54O5Si and a molecular weight of 510.83 g/mol. Its IUPAC name is ethyl (Z)-10-[(4S,5R)-5-[(Z,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]dec-9-enoate.
| Compound Name | ethyl (Z)-10-[(4S,5R)-5-[(Z,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]dec-9-enoate |
|---|---|
| PubChem CID | 10994821 |
| Molecular Formula | C29H54O5Si |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | ethyl (Z)-10-[(4S,5R)-5-[(Z,1S)-1-[tert-butyl(dimethyl)silyl]oxyhex-3-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]dec-9-enoate |
| SMILES | CC/C=C\C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1/C=C\CCCCCCCC(=O)OCC |
| InChI | InChI=1S/C29H54O5Si/c1-10-12-18-22-25(34-35(8,9)28(3,4)5)27-24(32-29(6,7)33-27)21-19-16-14-13-15-17-20-23-26(30)31-11-2/h12,18-19,21,24-25,27H,10-11,13-17,20,22-23H2,1-9H3/b18-12-,21-19-/t24-,25-,27+/m0/s1 |
| InChIKey | QGSFLCVEYSNBMZ-DNPJPOKSSA-N |
| XLogP | 8.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|