C28H54O7Si — CID 11785884
methyl 3-[(4R,5R)-5-[(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)undec-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 11785884) has the molecular formula C28H54O7Si and a molecular weight of 530.82 g/mol. Its IUPAC name is methyl 3-[(4R,5R)-5-[(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)undec-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | methyl 3-[(4R,5R)-5-[(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)undec-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 11785884 |
| Molecular Formula | C28H54O7Si |
| Molecular Weight | 530.82 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | methyl 3-[(4R,5R)-5-[(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)undec-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | CCCCCC[C@H](OCOC)[C@H](C/C=C/[C@H]1OC(C)(C)O[C@@H]1CCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O7Si/c1-11-12-13-14-16-22(32-21-30-7)25(35-36(9,10)27(2,3)4)18-15-17-23-24(19-20-26(29)31-8)34-28(5,6)33-23/h15,17,22-25H,11-14,16,18-21H2,1-10H3/b17-15+/t22-,23+,24+,25-/m0/s1 |
| InChIKey | WHRGZNFYSRWGML-VXHWKPHQSA-N |
| XLogP | 6.76 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.82 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|