C25H42O8 — CID 11363404
methyl (E,5R,6R)-5-[3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoyloxy]-6-(methoxymethoxy)dodec-2-enoate (PubChem CID 11363404) has the molecular formula C25H42O8 and a molecular weight of 470.60 g/mol. Its IUPAC name is methyl (E,5R,6R)-5-[3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoyloxy]-6-(methoxymethoxy)dodec-2-enoate.
| Compound Name | methyl (E,5R,6R)-5-[3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoyloxy]-6-(methoxymethoxy)dodec-2-enoate |
|---|---|
| PubChem CID | 11363404 |
| Molecular Formula | C25H42O8 |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | methyl (E,5R,6R)-5-[3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoyloxy]-6-(methoxymethoxy)dodec-2-enoate |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@H]1CCC(=O)O[C@H](C/C=C/C(=O)OC)[C@@H](CCCCCC)OCOC |
| InChI | InChI=1S/C25H42O8/c1-7-9-10-11-13-20(30-18-28-5)21(14-12-15-23(26)29-6)31-24(27)17-16-22-19(8-2)32-25(3,4)33-22/h8,12,15,19-22H,2,7,9-11,13-14,16-18H2,1,3-6H3/b15-12+/t19-,20+,21+,22-/m0/s1 |
| InChIKey | NIBNIKWCHUINCW-CITBOHMRSA-N |
| XLogP | 4.46 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|