C18H26O6 — CID 134847024
[(E,1R)-1-[(2R)-5-oxooxolan-2-yl]-3-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]prop-2-enyl] (E)-2-methylbut-2-enoate (PubChem CID 134847024) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is [(E,1R)-1-[(2R)-5-oxooxolan-2-yl]-3-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]prop-2-enyl] (E)-2-methylbut-2-enoate.
| Compound Name | [(E,1R)-1-[(2R)-5-oxooxolan-2-yl]-3-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]prop-2-enyl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 134847024 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [(E,1R)-1-[(2R)-5-oxooxolan-2-yl]-3-[(4R,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]prop-2-enyl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H](/C=C/[C@H]1OC(C)(C)O[C@H]1C)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C18H26O6/c1-6-11(2)17(20)22-15(14-9-10-16(19)21-14)8-7-13-12(3)23-18(4,5)24-13/h6-8,12-15H,9-10H2,1-5H3/b8-7+,11-6+/t12-,13+,14+,15+/m0/s1 |
| InChIKey | BCYBDLMPZNAOCU-RGPHHYNVSA-N |
| XLogP | 2.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|