C23H40O6 — CID 11338910
[(4S,5S)-5-(methoxymethoxy)undec-1-en-4-yl] 3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 11338910) has the molecular formula C23H40O6 and a molecular weight of 412.57 g/mol. Its IUPAC name is [(4S,5S)-5-(methoxymethoxy)undec-1-en-4-yl] 3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | [(4S,5S)-5-(methoxymethoxy)undec-1-en-4-yl] 3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 11338910 |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | [(4S,5S)-5-(methoxymethoxy)undec-1-en-4-yl] 3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | C=CC[C@H](OC(=O)CC[C@H]1OC(C)(C)O[C@@H]1C=C)[C@H](CCCCCC)OCOC |
| InChI | InChI=1S/C23H40O6/c1-7-10-11-12-14-19(26-17-25-6)20(13-8-2)27-22(24)16-15-21-18(9-3)28-23(4,5)29-21/h8-9,18-21H,2-3,7,10-17H2,1,4-6H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | NKYDHWIKISOMOI-IVAOSVALSA-N |
| XLogP | 4.92 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|