C12H19IO4 — CID 10784296
ethyl 3-[(4S,5S)-5-[(Z)-2-iodoethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 10784296) has the molecular formula C12H19IO4 and a molecular weight of 354.18 g/mol. Its IUPAC name is ethyl 3-[(4S,5S)-5-[(Z)-2-iodoethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | ethyl 3-[(4S,5S)-5-[(Z)-2-iodoethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 10784296 |
| Molecular Formula | C12H19IO4 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | ethyl 3-[(4S,5S)-5-[(Z)-2-iodoethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@H]1OC(C)(C)O[C@H]1/C=C\I |
| InChI | InChI=1S/C12H19IO4/c1-4-15-11(14)6-5-9-10(7-8-13)17-12(2,3)16-9/h7-10H,4-6H2,1-3H3/b8-7-/t9-,10-/m0/s1 |
| InChIKey | CWMCLVSCVMHDLL-OWSSEVEYSA-N |
| XLogP | 2.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|