3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid

C10H16O4 — CID 72960831

IUPAC3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid
SMILESC=CC1OC(C)(C)OC1CCC(=O)O
InChIInChI=1S/C10H16O4/c1-4-7-8(5-6-9(11)12)14-10(2,3)13-7/h4,7-8H,1,5-6H2,2-3H3,(H,11,12)
InChIKeyVITSFURXRFGFGD-UHFFFAOYSA-N
MW200.23 g/mol
LogP1.56
Rot. Bonds4

About 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid

3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid (PubChem CID 72960831) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid.

Molecular Properties

Compound Name3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid
PubChem CID72960831
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Name3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid
SMILESC=CC1OC(C)(C)OC1CCC(=O)O
InChIInChI=1S/C10H16O4/c1-4-7-8(5-6-9(11)12)14-10(2,3)13-7/h4,7-8H,1,5-6H2,2-3H3,(H,11,12)
InChIKeyVITSFURXRFGFGD-UHFFFAOYSA-N
XLogP1.56
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 51.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid?
The IUPAC name of 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid (CID 72960831) is 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid.
What is the SMILES notation for 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid?
The canonical SMILES for 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid is C=CC1OC(C)(C)OC1CCC(=O)O.
What is the InChIKey of 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid?
The InChIKey is VITSFURXRFGFGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-4-7-8(5-6-9(11)12)14-10(2,3)13-7/h4,7-8H,1,5-6H2,2-3H3,(H,11,12).
What are the key properties of 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid?
3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid has a molecular weight of 200.23 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)propanoic acid is sourced from PubChem (CID 72960831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).