C12H18O6 — CID 23730463
(5S,6R)-5,6-diacetyloxyoct-7-enoic acid (PubChem CID 23730463) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is (5S,6R)-5,6-diacetyloxyoct-7-enoic acid.
| Compound Name | (5S,6R)-5,6-diacetyloxyoct-7-enoic acid |
|---|---|
| PubChem CID | 23730463 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (5S,6R)-5,6-diacetyloxyoct-7-enoic acid |
| SMILES | C=C[C@@H](OC(C)=O)[C@H](CCCC(=O)O)OC(C)=O |
| InChI | InChI=1S/C12H18O6/c1-4-10(17-8(2)13)11(18-9(3)14)6-5-7-12(15)16/h4,10-11H,1,5-7H2,2-3H3,(H,15,16)/t10-,11+/m1/s1 |
| InChIKey | ZDYHSFRVAHEEGW-MNOVXSKESA-N |
| XLogP | 1.29 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|