C26H46O10Si — CID 135027952
(4R,7E,9R,10S,15R,16S)-15-[tert-butyl(dimethyl)silyl]oxy-9-(2-methoxyethoxymethoxy)-4,10,16-trimethyl-1,5,11-trioxacyclohexadec-7-ene-2,6,12-trione (PubChem CID 135027952) has the molecular formula C26H46O10Si and a molecular weight of 546.73 g/mol. Its IUPAC name is (4R,7E,9R,10S,15R,16S)-15-[tert-butyl(dimethyl)silyl]oxy-9-(2-methoxyethoxymethoxy)-4,10,16-trimethyl-1,5,11-trioxacyclohexadec-7-ene-2,6,12-trione.
| Compound Name | (4R,7E,9R,10S,15R,16S)-15-[tert-butyl(dimethyl)silyl]oxy-9-(2-methoxyethoxymethoxy)-4,10,16-trimethyl-1,5,11-trioxacyclohexadec-7-ene-2,6,12-trione |
|---|---|
| PubChem CID | 135027952 |
| Molecular Formula | C26H46O10Si |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | (4R,7E,9R,10S,15R,16S)-15-[tert-butyl(dimethyl)silyl]oxy-9-(2-methoxyethoxymethoxy)-4,10,16-trimethyl-1,5,11-trioxacyclohexadec-7-ene-2,6,12-trione |
| SMILES | COCCOCO[C@@H]1/C=C/C(=O)O[C@H](C)CC(=O)O[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)CCC(=O)O[C@H]1C |
| InChI | InChI=1S/C26H46O10Si/c1-18-16-25(29)35-20(3)22(36-37(8,9)26(4,5)6)11-13-24(28)34-19(2)21(10-12-23(27)33-18)32-17-31-15-14-30-7/h10,12,18-22H,11,13-17H2,1-9H3/b12-10+/t18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | KIPMQHLZQUBCBJ-OMPAJDEKSA-N |
| XLogP | 3.92 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|