C28H50O10Si — CID 135027951
[(2S,3R)-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate (PubChem CID 135027951) has the molecular formula C28H50O10Si and a molecular weight of 574.78 g/mol. Its IUPAC name is [(2S,3R)-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate.
| Compound Name | [(2S,3R)-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate |
|---|---|
| PubChem CID | 135027951 |
| Molecular Formula | C28H50O10Si |
| Molecular Weight | 574.78 g/mol |
| Exact Mass | 574.32 |
| IUPAC Name | [(2S,3R)-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate |
| SMILES | C=CC(=O)O[C@H](C)CC(=O)O[C@@H](C)[C@@H](CCC(=O)O[C@@H](C)[C@@H](C=C)OCOCCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H50O10Si/c1-12-23(34-19-33-17-16-32-9)21(4)36-26(30)15-14-24(38-39(10,11)28(6,7)8)22(5)37-27(31)18-20(3)35-25(29)13-2/h12-13,20-24H,1-2,14-19H2,3-11H3/t20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | PFAOLHUHJLWLSP-OYTPZHDJSA-N |
| XLogP | 4.72 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.78 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|