C16H30O5Si — CID 11012955
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid (PubChem CID 11012955) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 11012955 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@H]1[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O5Si/c1-9-11-14(20-16(5,6)19-11)12(10-13(17)18)21-22(7,8)15(2,3)4/h9,11-12,14H,1,10H2,2-8H3,(H,17,18)/t11-,12-,14+/m1/s1 |
| InChIKey | ANNCGTHLQQFGBG-BZPMIXESSA-N |
| XLogP | 3.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|