C20H38O6Si — CID 139260455
(2R)-2-[(4R,5R)-5-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetic acid (PubChem CID 139260455) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is (2R)-2-[(4R,5R)-5-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetic acid.
| Compound Name | (2R)-2-[(4R,5R)-5-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetic acid |
|---|---|
| PubChem CID | 139260455 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (2R)-2-[(4R,5R)-5-[(E,1R)-1-[tert-butyl(dimethyl)silyl]oxy-4-methylpent-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxyacetic acid |
| SMILES | CO[C@@H](C(=O)O)[C@@H]1OC(C)(C)O[C@H]1[C@@H](/C=C/C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O6Si/c1-13(2)11-12-14(26-27(9,10)19(3,4)5)15-16(17(23-8)18(21)22)25-20(6,7)24-15/h11-17H,1-10H3,(H,21,22)/b12-11+/t14-,15+,16-,17-/m1/s1 |
| InChIKey | KNEWRXZXMZOGOU-UBXDWVQHSA-N |
| XLogP | 4.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|