C17H32O6Si — CID 11530591
(2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxypropanoic acid (PubChem CID 11530591) has the molecular formula C17H32O6Si and a molecular weight of 360.52 g/mol. Its IUPAC name is (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxypropanoic acid.
| Compound Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 11530591 |
| Molecular Formula | C17H32O6Si |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | (2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methoxypropanoic acid |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC)C(=O)O |
| InChI | InChI=1S/C17H32O6Si/c1-10-11-12(22-17(5,6)21-11)13(14(20-7)15(18)19)23-24(8,9)16(2,3)4/h10-14H,1H2,2-9H3,(H,18,19)/t11-,12+,13-,14-/m1/s1 |
| InChIKey | XADNKAKJQJTNJN-XJFOESAGSA-N |
| XLogP | 3.18 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|