C18H32O6Si — CID 101036385
(5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopentanoic acid (PubChem CID 101036385) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is (5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopentanoic acid.
| Compound Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopentanoic acid |
|---|---|
| PubChem CID | 101036385 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopentanoic acid |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@H]1[C@@H](CC(=O)CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H32O6Si/c1-9-13-16(23-18(5,6)22-13)14(10-12(19)11-15(20)21)24-25(7,8)17(2,3)4/h9,13-14,16H,1,10-11H2,2-8H3,(H,20,21)/t13-,14-,16+/m1/s1 |
| InChIKey | IJZCTKWFXINFDT-FMKPAKJESA-N |
| XLogP | 3.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|