C27H52O7Si — CID 11443744
3-[(4R,5R)-5-[(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)undec-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid (PubChem CID 11443744) has the molecular formula C27H52O7Si and a molecular weight of 516.79 g/mol. Its IUPAC name is 3-[(4R,5R)-5-[(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)undec-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid.
| Compound Name | 3-[(4R,5R)-5-[(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)undec-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid |
|---|---|
| PubChem CID | 11443744 |
| Molecular Formula | C27H52O7Si |
| Molecular Weight | 516.79 g/mol |
| Exact Mass | 516.35 |
| IUPAC Name | 3-[(4R,5R)-5-[(E,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(methoxymethoxy)undec-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid |
| SMILES | CCCCCC[C@H](OCOC)[C@H](C/C=C/[C@H]1OC(C)(C)O[C@@H]1CCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O7Si/c1-10-11-12-13-15-21(31-20-30-7)24(34-35(8,9)26(2,3)4)17-14-16-22-23(18-19-25(28)29)33-27(5,6)32-22/h14,16,21-24H,10-13,15,17-20H2,1-9H3,(H,28,29)/b16-14+/t21-,22+,23+,24-/m0/s1 |
| InChIKey | RJWUYIFUGDOIQA-HURQEWJCSA-N |
| XLogP | 6.67 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.79 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|