C19H32O5 — CID 12016595
(3aR,8S,10E,11aR)-8-[(1S)-1-hydroxyheptyl]-2,2-dimethyl-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-e]oxecin-6-one (PubChem CID 12016595) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is (3aR,8S,10E,11aR)-8-[(1S)-1-hydroxyheptyl]-2,2-dimethyl-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-e]oxecin-6-one.
| Compound Name | (3aR,8S,10E,11aR)-8-[(1S)-1-hydroxyheptyl]-2,2-dimethyl-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-e]oxecin-6-one |
|---|---|
| PubChem CID | 12016595 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (3aR,8S,10E,11aR)-8-[(1S)-1-hydroxyheptyl]-2,2-dimethyl-3a,4,5,8,9,11a-hexahydro-[1,3]dioxolo[4,5-e]oxecin-6-one |
| SMILES | CCCCCC[C@H](O)[C@@H]1C/C=C/[C@H]2OC(C)(C)O[C@@H]2CCC(=O)O1 |
| InChI | InChI=1S/C19H32O5/c1-4-5-6-7-9-14(20)15-10-8-11-16-17(12-13-18(21)22-15)24-19(2,3)23-16/h8,11,14-17,20H,4-7,9-10,12-13H2,1-3H3/b11-8+/t14-,15-,16+,17+/m0/s1 |
| InChIKey | SCZXFULEPJQOOQ-ISFSCYEMSA-N |
| XLogP | 3.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|