C21H42O7Si — CID 135028262
[(2S,3R)-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhexanoate (PubChem CID 135028262) has the molecular formula C21H42O7Si and a molecular weight of 434.65 g/mol. Its IUPAC name is [(2S,3R)-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhexanoate.
| Compound Name | [(2S,3R)-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhexanoate |
|---|---|
| PubChem CID | 135028262 |
| Molecular Formula | C21H42O7Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [(2S,3R)-3-(2-methoxyethoxymethoxy)pent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhexanoate |
| SMILES | C=C[C@@H](OCOCCOC)[C@H](C)OC(=O)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)O |
| InChI | InChI=1S/C21H42O7Si/c1-10-18(26-15-25-14-13-24-7)17(3)27-20(23)12-11-19(16(2)22)28-29(8,9)21(4,5)6/h10,16-19,22H,1,11-15H2,2-9H3/t16-,17-,18+,19+/m0/s1 |
| InChIKey | DCGDHPRXMPJLLC-INDMIFKZSA-N |
| XLogP | 3.66 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|