C11H18O6 — CID 11557819
(2R,3R)-3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methoxypropanoic acid (PubChem CID 11557819) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is (2R,3R)-3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methoxypropanoic acid.
| Compound Name | (2R,3R)-3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 11557819 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | (2R,3R)-3-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-hydroxy-2-methoxypropanoic acid |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@H]1[C@@H](O)[C@@H](OC)C(=O)O |
| InChI | InChI=1S/C11H18O6/c1-5-6-8(17-11(2,3)16-6)7(12)9(15-4)10(13)14/h5-9,12H,1H2,2-4H3,(H,13,14)/t6-,7-,8+,9-/m1/s1 |
| InChIKey | GIAMBHQRLNGLOP-LURQLKTLSA-N |
| XLogP | 0.15 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|