C11H16O6 — CID 164675661
(4S,5R)-5-[(1S)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 164675661) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is (4S,5R)-5-[(1S)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4S,5R)-5-[(1S)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 164675661 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (4S,5R)-5-[(1S)-1-acetyloxyprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | C=C[C@H](OC(C)=O)[C@H]1OC(C)(C)O[C@@H]1C(=O)O |
| InChI | InChI=1S/C11H16O6/c1-5-7(15-6(2)12)8-9(10(13)14)17-11(3,4)16-8/h5,7-9H,1H2,2-4H3,(H,13,14)/t7-,8+,9-/m0/s1 |
| InChIKey | CTEOGXNTGNHKFJ-YIZRAAEISA-N |
| XLogP | 0.71 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|