C8H12O4 — CID 11401027
(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 11401027) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is (4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 11401027 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | C=C[C@H]1OC(C)(C)O[C@H]1C(=O)O |
| InChI | InChI=1S/C8H12O4/c1-4-5-6(7(9)10)12-8(2,3)11-5/h4-6H,1H2,2-3H3,(H,9,10)/t5-,6-/m1/s1 |
| InChIKey | CBUWPZJLBKWKCP-PHDIDXHHSA-N |
| XLogP | 0.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|