C13H20O4 — CID 102220969
(4R,5R)-2,2-dimethyl-5-[(1E,3R)-3-methylhexa-1,5-dienyl]-1,3-dioxolane-4-carboxylic acid (PubChem CID 102220969) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (4R,5R)-2,2-dimethyl-5-[(1E,3R)-3-methylhexa-1,5-dienyl]-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4R,5R)-2,2-dimethyl-5-[(1E,3R)-3-methylhexa-1,5-dienyl]-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 102220969 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (4R,5R)-2,2-dimethyl-5-[(1E,3R)-3-methylhexa-1,5-dienyl]-1,3-dioxolane-4-carboxylic acid |
| SMILES | C=CC[C@@H](C)/C=C/[C@H]1OC(C)(C)O[C@H]1C(=O)O |
| InChI | InChI=1S/C13H20O4/c1-5-6-9(2)7-8-10-11(12(14)15)17-13(3,4)16-10/h5,7-11H,1,6H2,2-4H3,(H,14,15)/b8-7+/t9-,10-,11-/m1/s1 |
| InChIKey | YATBCOCCZZLEQU-QMVIJHPZSA-N |
| XLogP | 2.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|