(3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid

C10H12O4 — CID 10607916

IUPAC(3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid
SMILESCC1(C)O[C@@H]2C=CC=C[C@]2(C(=O)O)O1
InChIInChI=1S/C10H12O4/c1-9(2)13-7-5-3-4-6-10(7,14-9)8(11)12/h3-7H,1-2H3,(H,11,12)/t7-,10+/m1/s1
InChIKeyXPHFHMGFWOJLJI-XCBNKYQSSA-N
MW196.20 g/mol
LogP1.09
Rot. Bonds1

About (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid

(3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid (PubChem CID 10607916) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid.

Molecular Properties

Compound Name(3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid
PubChem CID10607916
Molecular FormulaC10H12O4
Molecular Weight196.20 g/mol
Exact Mass196.07
IUPAC Name(3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid
SMILESCC1(C)O[C@@H]2C=CC=C[C@]2(C(=O)O)O1
InChIInChI=1S/C10H12O4/c1-9(2)13-7-5-3-4-6-10(7,14-9)8(11)12/h3-7H,1-2H3,(H,11,12)/t7-,10+/m1/s1
InChIKeyXPHFHMGFWOJLJI-XCBNKYQSSA-N
XLogP1.09
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.20
LogP ≤ 51.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid?
The IUPAC name of (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid (CID 10607916) is (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid.
What is the SMILES notation for (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid?
The canonical SMILES for (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid is CC1(C)O[C@@H]2C=CC=C[C@]2(C(=O)O)O1.
What is the InChIKey of (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid?
The InChIKey is XPHFHMGFWOJLJI-XCBNKYQSSA-N. The full InChI is InChI=1S/C10H12O4/c1-9(2)13-7-5-3-4-6-10(7,14-9)8(11)12/h3-7H,1-2H3,(H,11,12)/t7-,10+/m1/s1.
What are the key properties of (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid?
(3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid has a molecular weight of 196.20 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid is sourced from PubChem (CID 10607916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).