About (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid
(3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid (PubChem CID 10607916) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid.
Analyze (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid?
The IUPAC name of (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid (CID 10607916) is (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid.
What is the SMILES notation for (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid?
The canonical SMILES for (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid is CC1(C)O[C@@H]2C=CC=C[C@]2(C(=O)O)O1.
What is the InChIKey of (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid?
The InChIKey is XPHFHMGFWOJLJI-XCBNKYQSSA-N. The full InChI is InChI=1S/C10H12O4/c1-9(2)13-7-5-3-4-6-10(7,14-9)8(11)12/h3-7H,1-2H3,(H,11,12)/t7-,10+/m1/s1.
What are the key properties of (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid?
(3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid has a molecular weight of 196.20 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS,7aR)-2,2-dimethyl-7aH-1,3-benzodioxole-3a-carboxylic acid is sourced from PubChem (CID 10607916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).