About ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate
ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate (PubChem CID 139747089) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate.
Analyze ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate (CID 139747089) is ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate is CCOC(=O)C1(O)C=CC(O)=CC1OCC.
What is the InChIKey of ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate?
The InChIKey is PXBDCVFNOYGNFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c1-3-15-9-7-8(12)5-6-11(9,14)10(13)16-4-2/h5-7,9,12,14H,3-4H2,1-2H3.
What are the key properties of ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate?
ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate has a molecular weight of 228.24 g/mol, XLogP of 0.70, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-ethoxy-1,4-dihydroxycyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 139747089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).