C8H12O4 — CID 10103604
ethyl (2R,3S)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate (PubChem CID 10103604) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is ethyl (2R,3S)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate.
| Compound Name | ethyl (2R,3S)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate |
|---|---|
| PubChem CID | 10103604 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | ethyl (2R,3S)-3-hydroxy-3,6-dihydro-2H-pyran-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1OCC=C[C@@H]1O |
| InChI | InChI=1S/C8H12O4/c1-2-11-8(10)7-6(9)4-3-5-12-7/h3-4,6-7,9H,2,5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | TUEGYHRLGIKHAL-NKWVEPMBSA-N |
| XLogP | -0.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|