C10H14O2S — CID 11830398
ethyl (4R,7S)-7-sulfanylspiro[2.4]hept-5-ene-4-carboxylate (PubChem CID 11830398) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is ethyl (4R,7S)-7-sulfanylspiro[2.4]hept-5-ene-4-carboxylate.
| Compound Name | ethyl (4R,7S)-7-sulfanylspiro[2.4]hept-5-ene-4-carboxylate |
|---|---|
| PubChem CID | 11830398 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | ethyl (4R,7S)-7-sulfanylspiro[2.4]hept-5-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C=C[C@H](S)C12CC2 |
| InChI | InChI=1S/C10H14O2S/c1-2-12-9(11)7-3-4-8(13)10(7)5-6-10/h3-4,7-8,13H,2,5-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | YAVRDQKISYAADL-YUMQZZPRSA-N |
| XLogP | 1.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|