C15H26O7 — CID 10495776
2-[(4S,5S)-5-[(E,3S,5R)-5-hydroxy-3-(methoxymethoxy)hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetic acid (PubChem CID 10495776) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-[(4S,5S)-5-[(E,3S,5R)-5-hydroxy-3-(methoxymethoxy)hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetic acid.
| Compound Name | 2-[(4S,5S)-5-[(E,3S,5R)-5-hydroxy-3-(methoxymethoxy)hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetic acid |
|---|---|
| PubChem CID | 10495776 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[(4S,5S)-5-[(E,3S,5R)-5-hydroxy-3-(methoxymethoxy)hex-1-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]acetic acid |
| SMILES | COCO[C@H](/C=C/[C@@H]1OC(C)(C)O[C@H]1CC(=O)O)C[C@@H](C)O |
| InChI | InChI=1S/C15H26O7/c1-10(16)7-11(20-9-19-4)5-6-12-13(8-14(17)18)22-15(2,3)21-12/h5-6,10-13,16H,7-9H2,1-4H3,(H,17,18)/b6-5+/t10-,11-,12+,13+/m1/s1 |
| InChIKey | ZYOCLIKCCDJGRZ-AHTXKAPNSA-N |
| XLogP | 1.30 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|