C12H16O5 — CID 44519220
(3aS,5R,7aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one (PubChem CID 44519220) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (3aS,5R,7aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one.
| Compound Name | (3aS,5R,7aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 44519220 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (3aS,5R,7aS)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one |
| SMILES | CC1(C)OC[C@@H]([C@H]2C=C[C@@H]3OC(=O)C[C@@H]3O2)O1 |
| InChI | InChI=1S/C12H16O5/c1-12(2)14-6-10(17-12)8-4-3-7-9(15-8)5-11(13)16-7/h3-4,7-10H,5-6H2,1-2H3/t7-,8+,9-,10-/m0/s1 |
| InChIKey | RDTRVMDTPGQGAM-JXUBOQSCSA-N |
| XLogP | 0.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|