C16H24O6 — CID 134878910
5-[(E)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]oxolan-2-one (PubChem CID 134878910) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is 5-[(E)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]oxolan-2-one.
| Compound Name | 5-[(E)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]oxolan-2-one |
|---|---|
| PubChem CID | 134878910 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 5-[(E)-2-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethenyl]oxolan-2-one |
| SMILES | CC1(C)O[C@H]([C@H]2COC(C)(C)O2)[C@@H](/C=C/C2CCC(=O)O2)O1 |
| InChI | InChI=1S/C16H24O6/c1-15(2)18-9-12(21-15)14-11(20-16(3,4)22-14)7-5-10-6-8-13(17)19-10/h5,7,10-12,14H,6,8-9H2,1-4H3/b7-5+/t10?,11-,12-,14+/m1/s1 |
| InChIKey | QAZQYOAEMJHNMD-GTOTWNGGSA-N |
| XLogP | 1.92 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|