C19H30O6 — CID 57163731
methyl 5-[(2S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,4-dioxaspiro[4.5]decan-2-yl]pent-4-enoate (PubChem CID 57163731) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is methyl 5-[(2S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,4-dioxaspiro[4.5]decan-2-yl]pent-4-enoate.
| Compound Name | methyl 5-[(2S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,4-dioxaspiro[4.5]decan-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 57163731 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | methyl 5-[(2S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,4-dioxaspiro[4.5]decan-2-yl]pent-4-enoate |
| SMILES | COC(=O)CCC=C[C@@H]1OC2(CCCCC2)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H30O6/c1-18(2)22-13-15(23-18)17-14(9-5-6-10-16(20)21-3)24-19(25-17)11-7-4-8-12-19/h5,9,14-15,17H,4,6-8,10-13H2,1-3H3/t14-,15+,17-/m0/s1 |
| InChIKey | OGNBPWZBPDQAJV-UXLLHSPISA-N |
| XLogP | 3.09 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|