C13H18O6 — CID 15674852
[(3aR,4R,5S,7aR)-4-acetyloxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate (PubChem CID 15674852) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is [(3aR,4R,5S,7aR)-4-acetyloxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate.
| Compound Name | [(3aR,4R,5S,7aR)-4-acetyloxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate |
|---|---|
| PubChem CID | 15674852 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [(3aR,4R,5S,7aR)-4-acetyloxy-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2OC(C)(C)O[C@@H]2C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H18O6/c1-7(14)16-9-5-6-10-12(11(9)17-8(2)15)19-13(3,4)18-10/h5-6,9-12H,1-4H3/t9-,10+,11+,12+/m0/s1 |
| InChIKey | UNQIFVJOLCMKPG-IRCOFANPSA-N |
| XLogP | 0.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|