C16H24O6 — CID 14104655
[(2R,3S)-3-acetyloxy-6-cyclohexyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 14104655) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is [(2R,3S)-3-acetyloxy-6-cyclohexyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S)-3-acetyloxy-6-cyclohexyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14104655 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [(2R,3S)-3-acetyloxy-6-cyclohexyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(OC2CCCCC2)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H24O6/c1-11(17)19-10-15-14(20-12(2)18)8-9-16(22-15)21-13-6-4-3-5-7-13/h8-9,13-16H,3-7,10H2,1-2H3/t14-,15+,16?/m0/s1 |
| InChIKey | PRTOYGXCUGXISF-QMRHZFGWSA-N |
| XLogP | 2.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|