C16H26O6 — CID 139210725
methyl (E,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)pent-2-enoate (PubChem CID 139210725) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is methyl (E,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)pent-2-enoate.
| Compound Name | methyl (E,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)pent-2-enoate |
|---|---|
| PubChem CID | 139210725 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | methyl (E,5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)pent-2-enoate |
| SMILES | COCO[C@@H](C/C=C/C(=O)OC)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C16H26O6/c1-18-12-20-13(7-6-8-15(17)19-2)14-11-21-16(22-14)9-4-3-5-10-16/h6,8,13-14H,3-5,7,9-12H2,1-2H3/b8-6+/t13-,14+/m0/s1 |
| InChIKey | QAHDPNNUMBAICG-DWOOFBTHSA-N |
| XLogP | 2.17 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|