C17H28O6 — CID 139210733
methyl (5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)-3-methylidenepentanoate (PubChem CID 139210733) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl (5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)-3-methylidenepentanoate.
| Compound Name | methyl (5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)-3-methylidenepentanoate |
|---|---|
| PubChem CID | 139210733 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | methyl (5S)-5-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-5-(methoxymethoxy)-3-methylidenepentanoate |
| SMILES | C=C(CC(=O)OC)C[C@H](OCOC)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C17H28O6/c1-13(10-16(18)20-3)9-14(21-12-19-2)15-11-22-17(23-15)7-5-4-6-8-17/h14-15H,1,4-12H2,2-3H3/t14-,15+/m0/s1 |
| InChIKey | JQBHQAUOWMJSFK-LSDHHAIUSA-N |
| XLogP | 2.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|