C13H20O5 — CID 71732531
methyl (E)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-4-hydroxybut-2-enoate (PubChem CID 71732531) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is methyl (E)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-4-hydroxybut-2-enoate.
| Compound Name | methyl (E)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-4-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 71732531 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | methyl (E)-4-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-4-hydroxybut-2-enoate |
| SMILES | COC(=O)/C=C/C(O)[C@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C13H20O5/c1-16-12(15)6-5-10(14)11-9-17-13(18-11)7-3-2-4-8-13/h5-6,10-11,14H,2-4,7-9H2,1H3/b6-5+/t10?,11-/m1/s1 |
| InChIKey | YRYOOAGHBMLDDB-FKIOHPNOSA-N |
| XLogP | 1.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|