C20H32O6 — CID 71003153
1,4-dioxaspiro[4.5]decan-3-yl-[2-[(E)-2-methoxyethenyl]-1,4-dioxaspiro[4.5]decan-3-yl]methanol (PubChem CID 71003153) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decan-3-yl-[2-[(E)-2-methoxyethenyl]-1,4-dioxaspiro[4.5]decan-3-yl]methanol.
| Compound Name | 1,4-dioxaspiro[4.5]decan-3-yl-[2-[(E)-2-methoxyethenyl]-1,4-dioxaspiro[4.5]decan-3-yl]methanol |
|---|---|
| PubChem CID | 71003153 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decan-3-yl-[2-[(E)-2-methoxyethenyl]-1,4-dioxaspiro[4.5]decan-3-yl]methanol |
| SMILES | CO/C=C/C1OC2(CCCCC2)OC1C(O)C1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C20H32O6/c1-22-13-8-15-18(26-20(24-15)11-6-3-7-12-20)17(21)16-14-23-19(25-16)9-4-2-5-10-19/h8,13,15-18,21H,2-7,9-12,14H2,1H3/b13-8+ |
| InChIKey | RAIJKJAUDNXFHX-MDWZMJQESA-N |
| XLogP | 3.03 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|