C14H22O6 — CID 10755623
methyl (Z)-3-[(7S,8R,9R)-8-hydroxy-9-[(1R)-1-hydroxyethyl]-6,10-dioxaspiro[4.5]decan-7-yl]prop-2-enoate (PubChem CID 10755623) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is methyl (Z)-3-[(7S,8R,9R)-8-hydroxy-9-[(1R)-1-hydroxyethyl]-6,10-dioxaspiro[4.5]decan-7-yl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[(7S,8R,9R)-8-hydroxy-9-[(1R)-1-hydroxyethyl]-6,10-dioxaspiro[4.5]decan-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10755623 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | methyl (Z)-3-[(7S,8R,9R)-8-hydroxy-9-[(1R)-1-hydroxyethyl]-6,10-dioxaspiro[4.5]decan-7-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C\[C@@H]1OC2(CCCC2)O[C@H]([C@@H](C)O)[C@@H]1O |
| InChI | InChI=1S/C14H22O6/c1-9(15)13-12(17)10(5-6-11(16)18-2)19-14(20-13)7-3-4-8-14/h5-6,9-10,12-13,15,17H,3-4,7-8H2,1-2H3/b6-5-/t9-,10+,12-,13-/m1/s1 |
| InChIKey | OTSYAOOGKHLSDN-BLPWEHNPSA-N |
| XLogP | 0.51 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|