C15H22O6 — CID 10859486
ethyl (E)-3-[(3aR,5R,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]prop-2-enoate (PubChem CID 10859486) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl (E)-3-[(3aR,5R,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(3aR,5R,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10859486 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl (E)-3-[(3aR,5R,6S,6aR)-6-hydroxyspiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane]-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1O[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C15H22O6/c1-2-18-11(16)7-6-10-12(17)13-14(19-10)21-15(20-13)8-4-3-5-9-15/h6-7,10,12-14,17H,2-5,8-9H2,1H3/b7-6+/t10-,12+,13-,14-/m1/s1 |
| InChIKey | JOGSFUFSYGUKOE-MRWNENIJSA-N |
| XLogP | 1.27 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|