C20H30O6 — CID 45358459
ethyl (E)-4-[(3aS,4S,7aR)-7-(2-oxoethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]-3-methylbut-2-enoate (PubChem CID 45358459) has the molecular formula C20H30O6 and a molecular weight of 366.45 g/mol. Its IUPAC name is ethyl (E)-4-[(3aS,4S,7aR)-7-(2-oxoethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]-3-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[(3aS,4S,7aR)-7-(2-oxoethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 45358459 |
| Molecular Formula | C20H30O6 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | ethyl (E)-4-[(3aS,4S,7aR)-7-(2-oxoethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-4-yl]-3-methylbut-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)C[C@@H]1OCC(CC=O)[C@H]2OC3(CCCCC3)O[C@@H]12 |
| InChI | InChI=1S/C20H30O6/c1-3-23-17(22)12-14(2)11-16-19-18(15(7-10-21)13-24-16)25-20(26-19)8-5-4-6-9-20/h10,12,15-16,18-19H,3-9,11,13H2,1-2H3/b14-12+/t15?,16-,18+,19-/m0/s1 |
| InChIKey | IRYBKLWEQKDDNM-RCCWLYHYSA-N |
| XLogP | 2.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|