C16H28N2O7S — CID 57270426
ethyl 4-[(3aS,4S,7R,7aR)-2,2-dimethyl-7-[(sulfamoylamino)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate (PubChem CID 57270426) has the molecular formula C16H28N2O7S and a molecular weight of 392.47 g/mol. Its IUPAC name is ethyl 4-[(3aS,4S,7R,7aR)-2,2-dimethyl-7-[(sulfamoylamino)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate.
| Compound Name | ethyl 4-[(3aS,4S,7R,7aR)-2,2-dimethyl-7-[(sulfamoylamino)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 57270426 |
| Molecular Formula | C16H28N2O7S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | ethyl 4-[(3aS,4S,7R,7aR)-2,2-dimethyl-7-[(sulfamoylamino)methyl]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate |
| SMILES | CCOC(=O)C=C(C)C[C@@H]1OC[C@@H](CNS(N)(=O)=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C16H28N2O7S/c1-5-22-13(19)7-10(2)6-12-15-14(24-16(3,4)25-15)11(9-23-12)8-18-26(17,20)21/h7,11-12,14-15,18H,5-6,8-9H2,1-4H3,(H2,17,20,21)/t11-,12+,14-,15+/m1/s1 |
| InChIKey | DXZWRXUKWRFMRU-OSRDXIQISA-N |
| XLogP | 0.21 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|