C9H14O4 — CID 52916605
methyl (E)-3-[(3S,4R)-3,4-dihydroxycyclopentyl]prop-2-enoate (PubChem CID 52916605) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl (E)-3-[(3S,4R)-3,4-dihydroxycyclopentyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(3S,4R)-3,4-dihydroxycyclopentyl]prop-2-enoate |
|---|---|
| PubChem CID | 52916605 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl (E)-3-[(3S,4R)-3,4-dihydroxycyclopentyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C9H14O4/c1-13-9(12)3-2-6-4-7(10)8(11)5-6/h2-3,6-8,10-11H,4-5H2,1H3/b3-2+/t6?,7-,8+ |
| InChIKey | JBCSCGJGLYJEBL-CYPXNPQDSA-N |
| XLogP | -0.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|