C11H17NO3 — CID 52915036
(E)-N-cyclopropyl-3-[(3S,4R)-3,4-dihydroxycyclopentyl]prop-2-enamide (PubChem CID 52915036) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-[(3S,4R)-3,4-dihydroxycyclopentyl]prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-[(3S,4R)-3,4-dihydroxycyclopentyl]prop-2-enamide |
|---|---|
| PubChem CID | 52915036 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (E)-N-cyclopropyl-3-[(3S,4R)-3,4-dihydroxycyclopentyl]prop-2-enamide |
| SMILES | O=C(/C=C/C1C[C@@H](O)[C@@H](O)C1)NC1CC1 |
| InChI | InChI=1S/C11H17NO3/c13-9-5-7(6-10(9)14)1-4-11(15)12-8-2-3-8/h1,4,7-10,13-14H,2-3,5-6H2,(H,12,15)/b4-1+/t7?,9-,10+ |
| InChIKey | WZSWPLMJNCMAOO-QLIURYDESA-N |
| XLogP | -0.05 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|