C11H16N2O — CID 131237415
(E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide (PubChem CID 131237415) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide.
| Compound Name | (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide |
|---|---|
| PubChem CID | 131237415 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide |
| SMILES | O=C(/C=C/C1CC1)NC1[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C11H16N2O/c14-10(4-3-7-1-2-7)13-11-8-5-12-6-9(8)11/h3-4,7-9,11-12H,1-2,5-6H2,(H,13,14)/b4-3+/t8-,9+,11? |
| InChIKey | QYEMCUSRPIRXKD-PEGTWCMNSA-N |
| XLogP | 0.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|