About (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide
(E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide (PubChem CID 131237415) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide |
| PubChem CID | 131237415 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide |
| SMILES | O=C(/C=C/C1CC1)NC1[C@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C11H16N2O/c14-10(4-3-7-1-2-7)13-11-8-5-12-6-9(8)11/h3-4,7-9,11-12H,1-2,5-6H2,(H,13,14)/b4-3+/t8-,9+,11? |
| InChIKey | QYEMCUSRPIRXKD-PEGTWCMNSA-N |
| XLogP | 0.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide?
The IUPAC name of (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide (CID 131237415) is (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide.
What is the SMILES notation for (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide?
The canonical SMILES for (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide is O=C(/C=C/C1CC1)NC1[C@H]2CNC[C@@H]12.
What is the InChIKey of (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide?
The InChIKey is QYEMCUSRPIRXKD-PEGTWCMNSA-N. The full InChI is InChI=1S/C11H16N2O/c14-10(4-3-7-1-2-7)13-11-8-5-12-6-9(8)11/h3-4,7-9,11-12H,1-2,5-6H2,(H,13,14)/b4-3+/t8-,9+,11?.
What are the key properties of (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide?
(E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide has a molecular weight of 192.26 g/mol, XLogP of 0.29, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(1R,5S)-3-azabicyclo[3.1.0]hexan-6-yl]-3-cyclopropylprop-2-enamide is sourced from PubChem (CID 131237415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).