C10H18ClN3O — CID 130644756
N-(3-azabicyclo[3.1.0]hexan-6-yl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 130644756) has the molecular formula C10H18ClN3O and a molecular weight of 231.73 g/mol. Its IUPAC name is N-(3-azabicyclo[3.1.0]hexan-6-yl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 130644756 |
| Molecular Formula | C10H18ClN3O |
| Molecular Weight | 231.73 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1C2CNCC21)C1CCNC1 |
| InChI | InChI=1S/C10H17N3O.ClH/c14-10(6-1-2-11-3-6)13-9-7-4-12-5-8(7)9;/h6-9,11-12H,1-5H2,(H,13,14);1H |
| InChIKey | TXIBFGAMEZFPDT-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.73 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |