C12H22ClN3O2 — CID 119802178
N-(2-carbamoylcyclohexyl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119802178) has the molecular formula C12H22ClN3O2 and a molecular weight of 275.78 g/mol. Its IUPAC name is N-(2-carbamoylcyclohexyl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(2-carbamoylcyclohexyl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119802178 |
| Molecular Formula | C12H22ClN3O2 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-(2-carbamoylcyclohexyl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)C1CCCCC1NC(=O)C1CCNC1 |
| InChI | InChI=1S/C12H21N3O2.ClH/c13-11(16)9-3-1-2-4-10(9)15-12(17)8-5-6-14-7-8;/h8-10,14H,1-7H2,(H2,13,16)(H,15,17);1H |
| InChIKey | VMRXDVJXIWHOOB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |