C24H36O4 — CID 11069154
methyl (Z)-7-[(4S,5R)-2,2-dimethyl-5-[(1Z,3E,5E,8Z)-undeca-1,3,5,8-tetraenyl]-1,3-dioxolan-4-yl]hept-5-enoate (PubChem CID 11069154) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is methyl (Z)-7-[(4S,5R)-2,2-dimethyl-5-[(1Z,3E,5E,8Z)-undeca-1,3,5,8-tetraenyl]-1,3-dioxolan-4-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(4S,5R)-2,2-dimethyl-5-[(1Z,3E,5E,8Z)-undeca-1,3,5,8-tetraenyl]-1,3-dioxolan-4-yl]hept-5-enoate |
|---|---|
| PubChem CID | 11069154 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | methyl (Z)-7-[(4S,5R)-2,2-dimethyl-5-[(1Z,3E,5E,8Z)-undeca-1,3,5,8-tetraenyl]-1,3-dioxolan-4-yl]hept-5-enoate |
| SMILES | CC/C=C\C/C=C/C=C/C=C\[C@H]1OC(C)(C)O[C@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C24H36O4/c1-5-6-7-8-9-10-11-12-15-18-21-22(28-24(2,3)27-21)19-16-13-14-17-20-23(25)26-4/h6-7,9-13,15-16,18,21-22H,5,8,14,17,19-20H2,1-4H3/b7-6-,10-9+,12-11+,16-13-,18-15-/t21-,22+/m1/s1 |
| InChIKey | YKICMRFPMZTNJO-ORFKFWRPSA-N |
| XLogP | 5.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|