C25H34O7 — CID 162999286
methyl (5Z,8Z,10E,12R,13S,14Z,16E)-12,13-diacetyloxy-18-oxoicosa-5,8,10,14,16-pentaenoate (PubChem CID 162999286) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is methyl (5Z,8Z,10E,12R,13S,14Z,16E)-12,13-diacetyloxy-18-oxoicosa-5,8,10,14,16-pentaenoate.
| Compound Name | methyl (5Z,8Z,10E,12R,13S,14Z,16E)-12,13-diacetyloxy-18-oxoicosa-5,8,10,14,16-pentaenoate |
|---|---|
| PubChem CID | 162999286 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | methyl (5Z,8Z,10E,12R,13S,14Z,16E)-12,13-diacetyloxy-18-oxoicosa-5,8,10,14,16-pentaenoate |
| SMILES | CCC(=O)/C=C/C=C\[C@H](OC(C)=O)[C@@H](/C=C/C=C\C/C=C\CCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C25H34O7/c1-5-22(28)16-14-15-18-24(32-21(3)27)23(31-20(2)26)17-12-10-8-6-7-9-11-13-19-25(29)30-4/h7-10,12,14-18,23-24H,5-6,11,13,19H2,1-4H3/b9-7-,10-8-,16-14+,17-12+,18-15-/t23-,24+/m1/s1 |
| InChIKey | JPOQCKMIOBGSRK-TUNABNCUSA-N |
| XLogP | 4.34 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|