C23H34O4 — CID 14056112
methyl (5Z,8Z,10E,12S,14Z,17Z)-12-acetyloxyicosa-5,8,10,14,17-pentaenoate (PubChem CID 14056112) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is methyl (5Z,8Z,10E,12S,14Z,17Z)-12-acetyloxyicosa-5,8,10,14,17-pentaenoate.
| Compound Name | methyl (5Z,8Z,10E,12S,14Z,17Z)-12-acetyloxyicosa-5,8,10,14,17-pentaenoate |
|---|---|
| PubChem CID | 14056112 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | methyl (5Z,8Z,10E,12S,14Z,17Z)-12-acetyloxyicosa-5,8,10,14,17-pentaenoate |
| SMILES | CC/C=C\C/C=C\C[C@@H](/C=C/C=C\C/C=C\CCCC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C23H34O4/c1-4-5-6-7-12-15-18-22(27-21(2)24)19-16-13-10-8-9-11-14-17-20-23(25)26-3/h5-6,9-13,15-16,19,22H,4,7-8,14,17-18,20H2,1-3H3/b6-5-,11-9-,13-10-,15-12-,19-16+/t22-/m0/s1 |
| InChIKey | RFNFBBJIGIIGSS-IFJHIGKFSA-N |
| XLogP | 5.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|