C18H32O6 — CID 10980857
ethyl (Z,4S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)non-5-enoate (PubChem CID 10980857) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is ethyl (Z,4S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)non-5-enoate.
| Compound Name | ethyl (Z,4S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)non-5-enoate |
|---|---|
| PubChem CID | 10980857 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | ethyl (Z,4S)-9-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(methoxymethoxy)non-5-enoate |
| SMILES | CCOC(=O)CC[C@@H](/C=C\CCC[C@@H]1COC(C)(C)O1)OCOC |
| InChI | InChI=1S/C18H32O6/c1-5-21-17(19)12-11-15(22-14-20-4)9-7-6-8-10-16-13-23-18(2,3)24-16/h7,9,15-16H,5-6,8,10-14H2,1-4H3/b9-7-/t15-,16-/m1/s1 |
| InChIKey | YLOOLLMCCUFERS-LRDXNBAQSA-N |
| XLogP | 3.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|